CymitQuimica logo

CAS 4919-00-0

:

methyl 4-amino-1H-imidazole-5-carboxylate

Description:
Methyl 4-amino-1H-imidazole-5-carboxylate, with the CAS number 4919-00-0, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an amino group (-NH2) and a carboxylate group (-COOCH3) attached to the imidazole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid, soluble in polar solvents such as water and methanol, which enhances its utility in various chemical reactions and applications. The presence of the amino group allows for potential interactions in biological systems, making it of interest in pharmaceutical research. Additionally, the carboxylate moiety can participate in acid-base reactions and serve as a site for further chemical modifications. Overall, methyl 4-amino-1H-imidazole-5-carboxylate is a versatile compound with applications in medicinal chemistry and organic synthesis.
Formula:C5H7N3O2
InChI:InChI=1/C5H7N3O2/c1-10-5(9)3-4(6)8-2-7-3/h2H,6H2,1H3,(H,7,8)
InChI key:DESDXDWZSJRLDB-UHFFFAOYSA-N
SMILES:COC(=O)c1c(N)[nH]cn1
Found 4 products.