CymitQuimica logo

CAS 4926-26-5

:

2-Bromo-4,6-dimethylpyridine

Description:
2-Bromo-4,6-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with bromine and two methyl groups. Its molecular formula is C8H10BrN, indicating the presence of carbon, hydrogen, bromine, and nitrogen atoms. The compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a distinct aromatic odor and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical synthesis applications, particularly in the preparation of pharmaceuticals and agrochemicals. Additionally, the methyl groups contribute to its lipophilicity and influence its electronic properties, affecting its reactivity and interaction with biological systems. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 2-Bromo-4,6-dimethylpyridine is a valuable compound in organic synthesis and research.
Formula:C7H8BrN
InChI:InChI=1S/C7H8BrN/c1-5-3-6(2)9-7(8)4-5/h3-4H,1-2H3
InChI key:IRTOCXBLUOPRFT-UHFFFAOYSA-N
SMILES:CC1=CC(=NC(=C1)Br)C
Found 5 products.