CAS 4942-47-6
:1-Adamantaneacetic acid
Description:
1-Adamantaneacetic acid, with the CAS number 4942-47-6, is a chemical compound characterized by its unique adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound features a carboxylic acid functional group (-COOH) attached to the adamantane framework, contributing to its acidic properties. It is typically a white crystalline solid at room temperature and is soluble in organic solvents, though its solubility in water is limited. The presence of the adamantane moiety imparts distinctive steric and electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. 1-Adamantaneacetic acid may exhibit biological activity, and its derivatives are often explored for potential therapeutic applications. Additionally, its structural characteristics allow for potential modifications that can enhance its properties or biological activity. Overall, this compound represents a fascinating intersection of organic chemistry and potential pharmacological utility.
Formula:C12H18O2
InChI:InChI=1S/C12H18O2/c13-11(14)7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2,(H,13,14)
InChI key:InChIKey=AOTQGWFNFTVXNQ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C12CC3CC(C1)CC(C2)C3
Synonyms:- (Adamantan-1-yl)acetic acid
- (Tricyclo[3.3.1.1<sup>3,7</sup>]dec-1-yl)acetic acid
- 1-(Carboxymethyl)adamantane
- 1-Adamantane Acetic Acid
- 1-Adamantaneacetic acid
- 1-Adamantylacetic acid
- 2-(1-Adamantyl)acetic acid
- 2-(Adamantan-1-yl)acetic acid
- Adamantylacetic acid
- NSC 310162
- Tricyclo[3.3.1.1<sup>3,7</sup>]decane-1-acetic acid
- Tricyclo[3.3.1.1~3,7~]Dec-1-Ylacetate
- Tricyclo[3.3.1.1~3,7~]Dec-1-Ylacetic Acid
- α-(1-Adamantyl)acetic acid
- Tricyclo(3.3.1.13,7)dec-1-ylacetic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1-Adamantaneacetic Acid
CAS:Formula:C12H18O2Purity:>99.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:194.271-Adamantaneacetic acid, 98+%
CAS:<p>1-Adamantaneacetic acid is used as an acylating agent in determining pharmacological characteristics of ten new analogues of bradykinin (Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg) that were modified in the N-terminal part of the molecule. This Thermo Scientific Chemicals brand product was originally part </p>Formula:C12H18O2Purity:98+%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:194.28Tricyclo[3.3.1.13,7]decane-1-acetic acid
CAS:Formula:C12H18O2Purity:98%Color and Shape:SolidMolecular weight:194.2701(Adamant-1-yl)acetic acid
CAS:(Adamant-1-yl)acetic acidFormula:C12H18O2Purity:98%Color and Shape: white solidMolecular weight:194.27g/mol1-Adamantane acetic acid
CAS:<p>1-Adamantane acetic acid is a naphthenic organic compound that has physiological effects. It is a hydrogen-bond acceptor and has a trifluoroacetic acid group. The compound inhibits mitochondrial function by inhibiting the enzyme ATPase, which is involved in the synthesis of ATP. 1-Adamantane acetic acid also inhibits tumor growth by inducing apoptosis in cancer cells. It has been shown to have potent antagonist activity against amide neurotransmitters such as acetylcholine and serotonin, which are involved in the regulation of muscle contractions and mood respectively.</p>Formula:C12H18O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:194.27 g/mol2-(Adamantan-1-yl)acetic acid
CAS:Formula:C12H18O2Purity:98%Color and Shape:Solid, Beige powderMolecular weight:194.274







