CymitQuimica logo

CAS 4949-69-3

:

4-Iodo-3-methylaniline

Description:
4-Iodo-3-methylaniline, with the CAS number 4949-69-3, is an organic compound that belongs to the class of anilines, which are aromatic amines. This compound features a benzene ring substituted with an amino group (-NH2), a methyl group (-CH3), and an iodine atom (-I) at specific positions on the ring. Its molecular formula is C8H10I N, indicating the presence of carbon, hydrogen, nitrogen, and iodine. The iodine substituent typically imparts unique reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution. The methyl group contributes to the compound's hydrophobic characteristics, while the amino group can engage in hydrogen bonding, affecting its solubility in polar solvents. 4-Iodo-3-methylaniline is often utilized in organic synthesis, particularly in the production of dyes, pharmaceuticals, and agrochemicals. As with many anilines, it may exhibit toxicity and should be handled with care in laboratory settings, adhering to appropriate safety protocols.
Formula:C7H8IN
InChI:InChI=1S/C7H8IN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3
InChI key:UISBOJCPTKUBIC-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)N)I
Found 4 products.