CymitQuimica logo

CAS 49594-75-4

:

3-(4-Ethylbenzoyl)propionic acid

Description:
3-(4-Ethylbenzoyl)propionic acid is an organic compound characterized by its structure, which includes a propionic acid moiety attached to a 4-ethylbenzoyl group. This compound features a carboxylic acid functional group, which imparts acidic properties and allows for potential hydrogen bonding. The presence of the ethyl group on the benzene ring contributes to its hydrophobic characteristics, influencing its solubility in various solvents. The compound is likely to exhibit moderate stability under standard conditions, but it may be sensitive to heat or light, which can lead to degradation. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. Additionally, the compound may exhibit specific reactivity patterns typical of carboxylic acids, such as esterification or acid-base reactions. Overall, 3-(4-Ethylbenzoyl)propionic acid is a versatile compound with unique properties that can be leveraged in various chemical applications.
Formula:C12H13O3
InChI:InChI=1/C12H14O3/c1-2-9-3-5-10(6-4-9)11(13)7-8-12(14)15/h3-6H,2,7-8H2,1H3,(H,14,15)/p-1
InChI key:ZLHLIRYSBPOFQB-UHFFFAOYSA-N
SMILES:CCc1ccc(cc1)C(=O)CCC(=O)[O-]
Synonyms:
  • 4-(4-Ethylphenyl)-4-oxobutanoic acid
  • Benzenebutanoic acid, 4-ethyl-gamma-oxo-
  • 4-(4-Ethylphenyl)-4-Oxobutanoate
Found 3 products.