CAS 4965-33-7
:7-Chloroquinaldine
Description:
7-Chloroquinaldine is an organic compound that belongs to the class of quinoline derivatives, characterized by the presence of a chlorine atom at the 7-position of the quinoline ring. Its molecular structure consists of a bicyclic system that includes a benzene ring fused to a pyridine ring, which contributes to its aromatic properties. This compound is typically a pale yellow to brown solid and is known for its moderate solubility in organic solvents. 7-Chloroquinaldine exhibits biological activity, making it of interest in medicinal chemistry, particularly for its potential use in the development of pharmaceuticals. It may also serve as an intermediate in the synthesis of various chemical compounds. The presence of the chlorine atom can influence its reactivity and interaction with biological systems. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact. Overall, 7-Chloroquinaldine is a significant compound in both industrial and research applications.
Formula:C10H8ClN
InChI:InChI=1/C10H8ClN/c1-7-2-3-8-4-5-9(11)6-10(8)12-7/h2-6H,1H3
InChI key:InChIKey=WQZQFYRSYLXBGP-UHFFFAOYSA-N
SMILES:ClC1=CC2=C(C=CC(C)=N2)C=C1
Synonyms:- 7-Chloro-2-methyl-quinoline
- 7-Chloro-2-methylquinoline
- Chloroquinaldine
- Quinaldine, 7-chloro-
- Quinoline, 7-chloro-2-methyl-
- 7-Chloroquinaldine
- 7ChloroQuinaldineMontelukast
- Chloroquinaldine,98%
- 7-ChloroQuinaldine98.5%
- 7-Chloroquinaldine ,99%
- 2-METHYL-7-CHLOROQUINOLINE
- Montelukast7-ChloroQuinaldine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
7-Chloroquinaldine
CAS:Formula:C10H8ClNPurity:>98.0%(GC)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:177.637-Chloro-2-methylquinoline
CAS:Formula:C10H8ClNPurity:98%Color and Shape:SolidMolecular weight:177.63027-Chloro-2-methylquinoline
CAS:7-Chloro-2-methylquinolineFormula:C10H8ClNPurity:97%Color and Shape: pale yellow solidMolecular weight:177.63g/mol7-Chloroquinaldine
CAS:Controlled ProductFormula:C14H15NO3Color and Shape:NeatMolecular weight:245.2747-Chloroquinaldine
CAS:7-Chloroquinaldine is a redox potential that is used in the industrial production of quinoline. It is also used as an intermediate for the synthesis of other organic compounds, such as 7-chloroquinoline and chloroquine. The reaction generally starts with sodium hydroxide solution (NaOH) and pyridine (C5H5N), which react to form sodium pyridinium chloride (NaC5H4N+Cl−). This compound reacts with chloroform (CHCl3) to form 7-chloroquinoline and hydrochloric acid (HCl). The reaction product can be purified by crystallization or by washing with water. A Friedel-Crafts reaction is then conducted using aluminum chloride, which reacts with the 7-chloroquinolone to produce 3,4-dichloropyridine. Finally, this compound reacts with hydrogen peroxide and potassium hydroxide to produce hydrogen chlorideFormula:C10H8ClNPurity:Min. 95%Color and Shape:PowderMolecular weight:177.63 g/mol








