CymitQuimica logo

CAS 49668-99-7

:

Ethyl 6-(chloromethyl)pyridine-2-carboxylate

Description:
Ethyl 6-(chloromethyl)pyridine-2-carboxylate is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2-position with a carboxylate group and at the 6-position with a chloromethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic characteristics. The presence of the chloromethyl group makes it a potential electrophile, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis. Additionally, the ethyl ester group contributes to its reactivity and solubility properties. Safety considerations should be taken into account, as chlorinated compounds can be hazardous, and appropriate handling and storage conditions are necessary to mitigate risks. Overall, Ethyl 6-(chloromethyl)pyridine-2-carboxylate is a versatile intermediate in the synthesis of various organic compounds.
Formula:C9H10ClNO2
InChI:InChI=1/C9H10ClNO2/c1-2-13-9(12)8-5-3-4-7(6-10)11-8/h3-5H,2,6H2,1H3
InChI key:UBRNJYSCVHFYDB-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cccc(CCl)n1
Synonyms:
  • 2-Pyridinecarboxylic acid, 6-(chloromethyl)-, ethyl ester
Found 4 products.