CymitQuimica logo

CAS 496921-73-4

:

1-[2-[4-(3-Chlorophenyl)piperazin-1-yl]ethyl]-4,5,6,7-tetrahydro-1H-indol-4-one

Description:
1-[2-[4-(3-Chlorophenyl)piperazin-1-yl]ethyl]-4,5,6,7-tetrahydro-1H-indol-4-one, with the CAS number 496921-73-4, is a chemical compound that belongs to the class of indole derivatives. It features a complex structure characterized by a tetrahydroindole core, which is fused with a piperazine moiety and a chlorophenyl group. This compound is often studied for its potential pharmacological properties, particularly in the context of neuropharmacology, as it may interact with various neurotransmitter systems. The presence of the piperazine ring suggests possible activity as a serotonin or dopamine receptor modulator, which is of interest in the development of therapeutic agents for psychiatric disorders. Additionally, the chlorophenyl substituent can influence the lipophilicity and overall biological activity of the compound. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be evaluated for its efficacy and safety in preclinical studies. As with many compounds in medicinal chemistry, understanding its structure-activity relationship is crucial for further development.
Formula:C20H24ClN3O
InChI:InChI=1S/C20H24ClN3O/c21-16-3-1-4-17(15-16)23-12-9-22(10-13-23)11-14-24-8-7-18-19(24)5-2-6-20(18)25/h1,3-4,7-8,15H,2,5-6,9-14H2
InChI key:CQSQHUPRBBCQRE-UHFFFAOYSA-N
SMILES:C1CC2=C(C=CN2CCN3CCN(CC3)C4=CC(=CC=C4)Cl)C(=O)C1
Synonyms:
  • Spi-376
  • Neo-376
Found 3 products.