CymitQuimica logo

CAS 497084-47-6

:

8-Quinolinamine, 3-iodo-

Description:
8-Quinolinamine, 3-iodo- is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of the amino group (-NH2) at the 8-position and an iodine atom at the 3-position of the quinoline ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit various physical properties such as solubility in organic solvents, depending on the specific conditions. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the amino group and the electron-withdrawing effect of the iodine atom. Additionally, 8-Quinolinamine derivatives are of interest in medicinal chemistry for their potential biological activities, including antimicrobial and anticancer properties. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 8-Quinolinamine, 3-iodo- is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H7IN2
InChI:InChI=1S/C9H7IN2/c10-7-4-6-2-1-3-8(11)9(6)12-5-7/h1-5H,11H2
InChI key:InChIKey=DXMKBPNVNXDMHP-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=C(I)C=N2)C=CC1
Synonyms:
  • 8-Quinolinamine, 3-iodo-
  • 3-Iodoquinolin-8-amine
Found 3 products.