CymitQuimica logo

CAS 497239-45-9

:

(3-phenyloxetan-3-yl)methanamine

Description:
(3-Phenyloxetan-3-yl)methanamine, with the CAS number 497239-45-9, is a chemical compound characterized by its unique structure, which includes an oxetane ring and a phenyl group. The oxetane ring is a four-membered cyclic ether, contributing to the compound's reactivity and potential applications in organic synthesis. The presence of the methanamine functional group indicates that it contains an amine, which can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. This compound may exhibit properties typical of both aromatic and aliphatic amines, including basicity and the ability to form hydrogen bonds. Its specific characteristics, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is placed. Due to its structural features, (3-phenyloxetan-3-yl)methanamine could be of interest in medicinal chemistry and materials science, potentially serving as a building block for more complex molecules or as a precursor in the synthesis of pharmaceuticals.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c11-6-10(7-12-8-10)9-4-2-1-3-5-9/h1-5H,6-8,11H2
InChI key:TVBXQZRCYHWTSD-UHFFFAOYSA-N
SMILES:C1C(CO1)(CN)C2=CC=CC=C2
Synonyms:
  • 3-Oxetanemethanamine, 3-Phenyl-
Found 3 products.