CymitQuimica logo

CAS 49773-19-5

:

2-(methylsulfinyl)ethanamine hydrochloride (1:1)

Description:
2-(Methylsulfinyl)ethanamine hydrochloride, with the CAS number 49773-19-5, is a chemical compound characterized by its amine functional group and the presence of a methylsulfinyl group. This substance typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound is often studied for its potential biological activities, including its role in medicinal chemistry and pharmacology. Its structure suggests that it may participate in various chemical reactions, particularly those involving nucleophilic substitution due to the amine group. Additionally, the methylsulfinyl moiety may contribute to its reactivity and interaction with biological systems. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C3H10ClNOS
InChI:InChI=1/C3H9NOS.ClH/c1-6(5)3-2-4;/h2-4H2,1H3;1H
InChI key:TWZPEKSMCMSPOB-UHFFFAOYSA-N
SMILES:CS(=O)CCN.Cl
Synonyms:
  • Ethanamine, 2-(Methylsulfinyl)-, Hydrochloride (1:1)
Found 2 products.