CymitQuimica logo

CAS 49791-37-9

:

oxo(pyrrolidin-1-yl)acetic acid

Description:
Oxo(pyrrolidin-1-yl)acetic acid, with the CAS number 49791-37-9, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an acetic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of the pyrrolidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the pyrrolidine ring may influence its lipophilicity and membrane permeability. Additionally, oxo(pyrrolidin-1-yl)acetic acid may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, its stability, reactivity, and potential toxicity would depend on the specific conditions under which it is handled and utilized.
Formula:C6H9NO3
InChI:InChI=1/C6H9NO3/c8-5(6(9)10)7-3-1-2-4-7/h1-4H2,(H,9,10)
InChI key:JMXACIJWOAVQRN-UHFFFAOYSA-N
SMILES:C1CCN(C1)C(=O)C(=O)O
Synonyms:
  • 1-Pyrrolidineacetic acid, alpha-oxo-
Found 4 products.