CymitQuimica logo

CAS 497959-39-4

:

1-Cyclohexene-1-carboxylic acid,2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester

Description:
1-Cyclohexene-1-carboxylic acid, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester is a chemical compound characterized by its unique structure that includes a cyclohexene ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both carboxylic acids and esters, such as moderate polarity and the ability to participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of the dioxaborolane group suggests potential applications in organic synthesis, particularly in cross-coupling reactions and as a boron source in various transformations. Additionally, the ethyl ester functionality may enhance its solubility in organic solvents, making it suitable for use in diverse chemical environments. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of catalysts. Overall, this compound represents a versatile building block in synthetic organic chemistry, with potential applications in pharmaceuticals and materials science.
Formula:C15H25BO4
InChI:InChI=1S/C15H25BO4/c1-6-18-13(17)11-9-7-8-10-12(11)16-19-14(2,3)15(4,5)20-16/h6-10H2,1-5H3
InChI key:LRAWEULWMCQGQZ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(CCCC2)C(=O)OCC
Found 4 products.