CAS 500-76-5
:4-(4-hydroxyphenoxy)benzoic acid
Description:
4-(4-Hydroxyphenoxy)benzoic acid, also known as p-hydroxyphenyl benzoate, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a hydroxyphenyl group. This compound features a hydroxyl (-OH) group attached to a phenyl ring, which enhances its solubility in polar solvents and contributes to its potential as a phenolic antioxidant. It typically appears as a white to off-white crystalline solid. The presence of both the carboxylic acid and the ether functionalities in its structure allows for various chemical reactivity, including esterification and potential interactions with other biomolecules. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug formulation and as a stabilizer in polymer systems. Its properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other chemical species.
Formula:C13H10O4
InChI:InChI=1/C13H10O4/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16/h1-8,14H,(H,15,16)
SMILES:c1cc(ccc1C(=O)O)Oc1ccc(cc1)O
Synonyms:- Benzoic Acid, 4-(4-Hydroxyphenoxy)-
- 4-(4-Hydroxyphenoxy)benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4-Hydroxyphenoxy)benzoic Acid
CAS:Formula:C13H10O4Purity:>99.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:230.224-(4-Hydroxyphenoxy)benzoic Acid
CAS:Formula:C13H10O4Purity:96%Color and Shape:SolidMolecular weight:230.21614-(4-Hydroxyphenoxy)benzoic acid
CAS:4-(4-Hydroxyphenoxy)benzoic acidFormula:C13H10O4Purity:98%Molecular weight:230.224-(4-Hydroxyphenoxy)benzoic acid
CAS:Formula:C13H10O4Purity:98%Color and Shape:SolidMolecular weight:230.2194-(4-Hydroxyphenoxy)benzoic acid
CAS:4-(4-Hydroxyphenoxy)benzoic acidFormula:C13H10O4Purity:96%Molecular weight:230.224-(4-Hydroxyphenoxy)benzoic acid
CAS:4-(4-Hydroxyphenoxy)benzoic acid is a molecule that can be used to treat hypercholesterolemia. It is metabolized in the body to butyric acid, which has been shown to have an anti-inflammatory effect on the bladder and may reduce water permeability of the bladder. 4-(4-Hydroxyphenoxy)benzoic acid can also be used as a choline precursor for acetylcholine synthesis and may have osmotic properties.Formula:C13H10O4Purity:Min. 95%Molecular weight:230.22 g/mol





