CymitQuimica logo

CAS 5001-96-7

:

(2-Fluorobiphenyl-4-yl)acetic acid

Description:
(2-Fluorobiphenyl-4-yl)acetic acid, with the CAS number 5001-96-7, is an organic compound characterized by its biphenyl structure substituted with a fluorine atom and an acetic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the biphenyl moiety. The presence of the fluorine atom can influence its chemical reactivity and physical properties, such as boiling and melting points, as well as its polarity. (2-Fluorobiphenyl-4-yl)acetic acid may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis often involves the introduction of the fluorine substituent onto the biphenyl framework, followed by the addition of the acetic acid group. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C14H11FO2
InChI:InChI=1/C14H11FO2/c15-13-8-10(9-14(16)17)6-7-12(13)11-4-2-1-3-5-11/h1-8H,9H2,(H,16,17)
InChI key:ZLLZRKQQNGBXRD-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1ccc(cc1F)CC(=O)O
Synonyms:
  • [1,1'-Biphenyl]-4-Acetic Acid, 2-Fluoro-
  • 2-Fluoro-biphenyl-4-acetic acid
Found 5 products.