CAS 5006-45-1
:6-Chloro-4-oxo-4H-1-benzopyran-2-carboxylic acid
Description:
6-Chloro-4-oxo-4H-1-benzopyran-2-carboxylic acid, with the CAS number 5006-45-1, is a chemical compound that belongs to the class of benzopyran derivatives. This substance features a benzopyran core structure, characterized by a fused benzene and pyran ring, which contributes to its aromatic properties. The presence of a chloro group at the 6-position and a carboxylic acid functional group at the 2-position enhances its reactivity and solubility in polar solvents. The keto group at the 4-position plays a crucial role in its chemical behavior, influencing its potential as a precursor in organic synthesis or as a bioactive compound. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in the development of pharmaceuticals, agrochemicals, or as a research tool in studying biochemical pathways. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C10H5ClO4
InChI:InChI=1S/C10H5ClO4/c11-5-1-2-8-6(3-5)7(12)4-9(15-8)10(13)14/h1-4H,(H,13,14)
InChI key:InChIKey=HALQFUWRVXLBIS-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(C(O)=O)=C1)=CC=C(Cl)C2
Synonyms:- 4H-1-Benzopyran-2-carboxylic acid, 6-chloro-4-oxo-
- 6-Chlorochromone-2-carboxylic acid
- 6-Chloro-4-oxo-4H-1-benzopyran-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Chlorochromone-2-carboxylic Acid
CAS:Formula:C10H5ClO4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:224.606-Chlorochromone-2-carboxylic acid
CAS:6-Chlorochromone-2-carboxylic acidFormula:C10H5ClO4Purity:≥95%Molecular weight:224.59736-Chlorochromone-2-carboxylic acid
CAS:Formula:C10H5ClO4Purity:96%Color and Shape:SolidMolecular weight:224.59736-Chlorochromone-2-carboxylic acid
CAS:6-Chlorochromone-2-carboxylic acid is a synthetic carboxylic acid that is a reagent in organic synthesis. It has been used to synthesize a number of new compounds, including substituted carboxylic acids and nitro compounds. The discovery of 6-chlorochromone-2-carboxylic acid was made possible by optimizing the reaction parameters, such as substituent and reaction time. This compound is cost effective and can be obtained from chromones.
Formula:C10H5ClO4Purity:Min. 95%Color and Shape:PowderMolecular weight:224.6 g/mol6-Chlorochromone-2-carboxylic acid
CAS:Formula:C10H5ClO4Purity:95%Color and Shape:SolidMolecular weight:224.6




