CymitQuimica logo

CAS 501433-06-3

:

2,3-Difluoro-1,4-diiodobenzene

Description:
2,3-Difluoro-1,4-diiodobenzene is an aromatic compound characterized by the presence of two fluorine atoms and two iodine atoms attached to a benzene ring. The fluorine atoms are located at the 2 and 3 positions, while the iodine atoms are at the 1 and 4 positions, making it a dihalogenated derivative of benzene. This compound is typically a solid at room temperature and exhibits a crystalline structure. Its molecular formula is C6H2F2I2, and it has a relatively high molecular weight due to the presence of heavy halogens. The presence of both fluorine and iodine introduces unique electronic and steric properties, which can influence its reactivity and interactions with other chemical species. 2,3-Difluoro-1,4-diiodobenzene may be used in various applications, including organic synthesis and materials science, particularly in the development of pharmaceuticals or as a precursor for more complex chemical structures. Its handling requires caution due to the potential toxicity associated with halogenated compounds.
Formula:C6H2F2I2
InChI:InChI=1S/C6H2F2I2/c7-5-3(9)1-2-4(10)6(5)8/h1-2H
InChI key:InChIKey=DXJHUCBRDBXOOA-UHFFFAOYSA-N
SMILES:FC1=C(F)C(I)=CC=C1I
Synonyms:
  • Benzene, 2,3-difluoro-1,4-diiodo-
  • 2,3-Difluoro-1,4-diiodobenzene
Found 4 products.