CymitQuimica logo

CAS 501698-03-9

:

Urea,N-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-N'-(3-methylphenyl)-

Description:
The chemical substance known as Urea, N-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-N'-(3-methylphenyl)-, with the CAS number 501698-03-9, is a complex organic compound characterized by its urea functional group, which is central to its structure. This compound features a thieno[2,3-d]pyrimidine moiety, indicating a fused ring system that contributes to its biological activity and potential pharmacological properties. The presence of amino and phenyl groups suggests that it may engage in hydrogen bonding and π-π interactions, which can influence its solubility and reactivity. Typically, such compounds are of interest in medicinal chemistry due to their potential as therapeutic agents, particularly in targeting specific biological pathways. The molecular structure implies a degree of lipophilicity, which may affect its absorption and distribution in biological systems. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, making it a subject of interest for further research and development in drug discovery.
Formula:C20H17N5OS
InChI:InChI=1S/C20H17N5OS/c1-12-3-2-4-15(9-12)25-20(26)24-14-7-5-13(6-8-14)16-10-27-19-17(16)18(21)22-11-23-19/h2-11H,1H3,(H2,21,22,23)(H2,24,25,26)
InChI key:DZSUJUOJJJCWGG-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)NC(=O)NC2=CC=C(C=C2)C3=CSC4=NC=NC(=C34)N
Found 7 products.