CAS 50298-90-3

Dihydrocucurbitacin F

Description:

Dihydrocucurbitacin F is a naturally occurring compound classified as a cucurbitacin, which are triterpenoid compounds known for their diverse biological activities. This substance is derived from various plants, particularly those in the Cucurbitaceae family, such as cucumbers and gourds. Dihydrocucurbitacin F is characterized by its complex tetracyclic structure, which contributes to its potential pharmacological properties. It exhibits a range of biological activities, including anti-inflammatory, anticancer, and antiparasitic effects, making it a subject of interest in medicinal chemistry and pharmacology. The compound is typically studied for its mechanisms of action and potential therapeutic applications. Additionally, due to its structural features, it may interact with various biological targets, influencing cellular pathways. However, the specific solubility, stability, and reactivity of Dihydrocucurbitacin F can vary depending on environmental conditions and the presence of other substances. As research continues, further insights into its properties and applications may emerge, enhancing our understanding of its role in natural product chemistry and potential health benefits.

Formula: C₃₀H₄₈O₇

InChI: InChI=1S/C30H48O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,17-20,23-24,31-32,35-37H,10-15H2,1-8H3/t17-,18+,19-,20+,23+,24-,27+,28-,29+,30+/m1/s1

InChI key: InChIKey=VVBWBGOEAVGFTN-LPQIEKFGSA-N

SMILES: C[C@]12[C@@](C)([C@@]([C@@](C(CCC(C)(C)O)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(C[C@H](O)[C@@H](O)C4(C)C)[H])[H]

Synonyms:

• (2β,3α,9β,10α,16α)-2,3,16,20,25-Pentahydroxy-9-methyl-19-norlanost-5-ene-11,22-dione
• 19-Norlanost-5-ene-11,22-dione, 2,3,16,20,25-pentahydroxy-9-methyl-, (2β,3α,9β,10α,16α)-
• 23,24-Dihydrocucurbitacin F
• Cucurbitacin II_b
• Cucurbitacin Iib
• Dihydrocucurbitacin F
• Hemslecin B
• estr-5-en-11-one, 17-[(1R)-1,5-dihydroxy-1,5-dimethyl-2-oxohexyl]-2,3,16-trihydroxy-4,4,9,14-tetramethyl-, (2beta,3alpha,9beta,10alpha,16alpha)-

Cucurbitacin IIb

CAS: 50298-90-3

Cucurbitacin IIb

Formula: C₃₀H₄₈O₇

Purity: ≥98%

Molecular weight: 520.7

Ref: 54-BUP04386

Cucurbitacin Ⅱb

CAS: 50298-90-3

Formula: C₃₀H₄₈O₇

Molecular weight: 520.71

Ref: 7W-GY6351

Cucurbitacin Ⅱb

CAS: 50298-90-3

Formula: C₃₀H₄₈O₇

Purity: 95%~99%

Molecular weight: 520.707

Ref: BP-BP0413

(2S,3S,8S,9R,10R,13R,14S,16R,17R)-17-((R)-2,6-Dihydroxy-6-methyl-3-oxoheptan-2-yl)-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-1,2,3,4,7,8,9,10,12,13,14,15,16,17-tetradecahydro-11H-cyclopenta[a]phenanthren-11-one

CAS: 50298-90-3

Formula: C₃₀H₄₈O₇

Purity: 99%

Molecular weight: 520.6979

Ref: IN-DA00DHMJ

Cucurbitacin IIb

CAS: 50298-90-3

Cucurbitacin IIb is an active ingredient in Hemsleyadine, used to treat dysentery and other infections; it has anti-inflammatory effects.

Formula: C₃₀H₄₈O₇

Purity: 98.66% - >99.99%

Color and Shape: Solid

Molecular weight: 520.6979

Ref: TM-T4S1469

Curcubitacin Iib

Controlled Product

CAS: 50298-90-3

Curcubitacin Iib is a natural product from the cucurbitaceae family that has been shown to have inhibitory effects against cancer. Curcubitacin Iib inhibits the mitochondrial membrane potential and activation markers in prostate cancer cells, which may be due to its ability to induce apoptosis. It also has an inhibitory effect on cell culture, which may be due to its ability to induce apoptosis. Curcubitacin Iib has been shown to have a bitter taste and is used as a natural flavor in food and beverages.

Purity: Min. 95%

Ref: 3D-FC74125