CAS 504-33-6
:(±)-Homocysteic acid
Description:
(±)-Homocysteic acid is a sulfur-containing amino acid derivative, specifically an α-amino acid that plays a role in various biological processes. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. The compound is characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH), along with a thiol group (-SH) that is integral to its structure. Homocysteic acid is known for its neuroactive properties, acting as an excitatory neurotransmitter in the central nervous system. It can participate in the synthesis of other important biomolecules and is involved in the metabolism of sulfur-containing amino acids. The compound exists as a racemic mixture, which means it contains equal amounts of both enantiomers, contributing to its biological activity. Its CAS number, 504-33-6, is a unique identifier used for chemical substances, facilitating its identification in scientific literature and databases. Overall, (±)-Homocysteic acid is significant in both biochemical research and potential therapeutic applications.
Formula:C4H9NO5S
InChI:InChI=1S/C4H9NO5S/c5-3(4(6)7)1-2-11(8,9)10/h3H,1-2,5H2,(H,6,7)(H,8,9,10)
InChI key:InChIKey=VBOQYPQEPHKASR-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)CS(=O)(=O)O
Synonyms:- (2R)-2-amino-4-sulfobutanoic acid
- (2R)-2-ammonio-4-sulfonatobutanoate
- (2S)-2-ammonio-4-sulfonatobutanoate
- (±)-Homocysteic acid
- 2-Amino-4-Sulfobutanoic Acid
- <span class="text-smallcaps">DL</span>-Homocysteic acid
- Butanoic acid, 2-amino-4-sulfo-
- Butyric acid, 2-amino-4-sulfo-, <span class="text-smallcaps">DL</span>-
- DL-Homocysteic acid
- Butyric acid, 2-amino-4-sulfo-, DL-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
DL-Homocysteic Acid
CAS:Formula:C4H9NO5SPurity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:183.18Butanoic acid, 2-amino-4-sulfo-
CAS:Formula:C4H9NO5SPurity:96%Color and Shape:SolidMolecular weight:183.18302-Amino-4-Sulfobutanoic Acid
CAS:2-Amino-4-Sulfobutanoic AcidFormula:C4H9NO5SPurity:97%Molecular weight:183.18DL-Homocysteic-3,3,4,4-d4 Acid
CAS:Formula:HO3SCD2CD2CH(NH2)COOHPurity:98 atom % DColor and Shape:White SolidMolecular weight:187.04525DL-Homocysteic acid
CAS:DL-Homocysteic acid is a useful organic compound for research related to life sciences. The catalog number is T124757 and the CAS number is 504-33-6.Formula:C4H9NO5SColor and Shape:SolidMolecular weight:183.18DL-Homocysteic acid
CAS:DL-Homocysteic acid is a polymer with the chemical formula of CH(CH)COOH. It is a metal chelate that has minimal toxicity and is used in the treatment of bowel disease. DL-Homocysteic acid is also used in biological samples to detect covalent linkages and receptor activity. In addition, this compound can be used as an experimental model for oxidative injury and enzyme activities.Formula:C4H9NO5SPurity:Min. 97 Area-%Color and Shape:PowderMolecular weight:183.18 g/mol2-Amino-4-sulfobutanoic acid
CAS:Formula:C4H9NO5SPurity:97%Color and Shape:SolidMolecular weight:183.18







