CymitQuimica logo

CAS 50476-72-7

:

ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate

Description:
Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom at the 4-position of the pyrazole ring enhances its electrophilic properties, making it a useful intermediate in various chemical reactions. Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's reactivity can be exploited in the synthesis of more complex molecules, making it a valuable building block in chemical research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H8ClN3O2
InChI:InChI=1/C9H8ClN3O2/c1-2-15-9(14)6-3-11-8-5(7(6)10)4-12-13-8/h3-4H,2H2,1H3,(H,11,12,13)
InChI key:PJMVISKPSDWZFO-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cnc2c(cn[nH]2)c1Cl
Synonyms:
  • Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate
Found 5 products.