CAS 505-95-3: 12-Hydroxydodecanoic acid
Description:12-Hydroxydodecanoic acid, also known as lauric acid 12-hydroxy derivative, is a fatty acid characterized by a long hydrocarbon chain with a hydroxyl group at the 12th carbon position. Its molecular formula is C12H24O3, and it features both hydrophobic and hydrophilic properties, making it amphiphilic. This compound is typically a white, waxy solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its long carbon chain. 12-Hydroxydodecanoic acid is primarily used in the production of surfactants, emulsifiers, and lubricants, and it can also serve as an intermediate in the synthesis of various chemical products. Additionally, it has applications in the cosmetic and pharmaceutical industries due to its moisturizing properties. The presence of the hydroxyl group enhances its reactivity, allowing for further chemical modifications. As with many fatty acids, it is important to handle this compound with care, as it may cause irritation upon contact with skin or eyes.
Formula:C12H24O3
InChI:InChI=1S/C12H24O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h13H,1-11H2,(H,14,15)
InChI key:InChIKey=ZDHCZVWCTKTBRY-UHFFFAOYSA-N
SMILES:O=C(O)CCCCCCCCCCCO
- Synonyms:
- 12-Hydroxydodecanoic acid
- Dodecanoic acid, 12-hydroxy-
- NSC 159293
- NSC 664211
- ω-Hydroxydodecanoic acid
- ω-Hydroxylauric acid
- 12-Hydroxylauric acid
