CAS 50530-12-6
:10-bromodecanoic acid
Description:
10-Bromodecanoic acid is a brominated fatty acid characterized by the presence of a bromine atom at the 10th carbon position of a decanoic acid chain. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic alkyl chain. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical synthesis applications, including the preparation of surfactants, pharmaceuticals, and agrochemicals. Its molecular structure contributes to its potential as a building block in organic synthesis, particularly in the development of functionalized materials. Additionally, 10-bromodecanoic acid may exhibit biological activity, which can be explored in various research contexts. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose health risks. Overall, 10-bromodecanoic acid serves as an important compound in both industrial and research settings due to its distinctive properties and reactivity.
Formula:C10H19BrO2
InChI:InChI=1/C10H19BrO2/c11-9-7-5-3-1-2-4-6-8-10(12)13/h1-9H2,(H,12,13)
SMILES:C(CCCCC(=O)O)CCCCBr
Synonyms:- 10-Bromo-Decylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
10-Bromodecanoic Acid
CAS:Formula:C10H19BrO2Purity:>97.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:251.1610-Bromodecanoic acid, 95%
CAS:It is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed asFormula:C10H19BrO2Purity:95%Molecular weight:251.16Ref: IN-DA003DU3
5g21.00€10g25.00€25g31.00€100g66.00€500g180.00€1kg357.00€5kg1,094.00€10kg2,082.00€25kg4,504.00€10-Bromodecanoic acid
CAS:10-Bromodecanoic acidFormula:C10H19BrO2Purity:98%Color and Shape:Solid-CrystalsMolecular weight:251.1606510-Bromodecanoic acid
CAS:10-Bromodecanoic acid (Decanoic acid, 10-bromo-) is a linker used in the synthesis of PROTACs, such as PROTAC KDM4 degrader-1.Formula:C10H19BrO2Color and Shape:SolidMolecular weight:251.161





