CymitQuimica logo

CAS 50571-61-4

:

L-Leucine, N-[(2-nitrophenyl)thio]-

Description:
L-Leucine, N-[(2-nitrophenyl)thio]- is a chemical compound characterized by its structure, which includes the amino acid L-leucine linked to a 2-nitrophenyl thio group. This compound features a branched-chain amino acid, which is essential for protein synthesis and plays a critical role in muscle metabolism. The presence of the nitrophenyl thio group introduces unique chemical properties, including potential reactivity due to the nitro group, which can participate in various chemical reactions. The compound may exhibit specific biological activities, making it of interest in pharmaceutical and biochemical research. Its CAS number, 50571-61-4, allows for precise identification in chemical databases. As with many compounds containing sulfur and nitro groups, it may have distinct solubility characteristics and stability profiles, which are important for its application in research and industry. Safety data should be consulted to understand its handling and potential hazards.
Formula:C12H16N2O4S
InChI:InChI=1S/C12H16N2O4S/c1-8(2)7-9(12(15)16)13-19-11-6-4-3-5-10(11)14(17)18/h3-6,8-9,13H,7H2,1-2H3,(H,15,16)/t9-/m0/s1
InChI key:OITRGNOZDXVYFU-VIFPVBQESA-N
SMILES:CC(C)C[C@@H](C(=O)O)NSC1=CC=CC=C1[N+](=O)[O-]
Found 1 products.