CymitQuimica logo

CAS 50670-51-4

:

4'-(bromomethyl)biphenyl-4-carbonitrile

Description:
4'-(Bromomethyl)biphenyl-4-carbonitrile, with the CAS number 50670-51-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromomethyl group (-CH2Br) at the para position of one of the phenyl rings and a cyano group (-CN) at the para position of the other ring contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its functional groups suggest that it can participate in nucleophilic substitution reactions, making it useful in the synthesis of various derivatives. Additionally, the bromomethyl group can serve as a versatile handle for further functionalization, while the cyano group can be involved in various chemical transformations, including hydrolysis and reduction. Overall, 4'-(bromomethyl)biphenyl-4-carbonitrile is a valuable intermediate in the field of organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C14H10BrN
InChI:InChI=1/C14H10BrN/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9H2
InChI key:RGZWLQDGQDLMJX-UHFFFAOYSA-N
SMILES:c1cc(ccc1CBr)c1ccc(cc1)C#N
Synonyms:
  • [1,1'-Biphenyl]-4-Carbonitrile, 4'-(Bromomethyl)-
Found 7 products.