CAS 50722-38-8: 3-Acetyldeoxynivalenol
Description:3-Acetyldeoxynivalenol (3-ADON) is a mycotoxin produced by certain strains of the fungus Fusarium graminearum, commonly found in cereal crops such as wheat and barley. It is a derivative of deoxynivalenol (DON), which is known for its toxic effects on humans and animals. 3-ADON is characterized by its acylated structure, which influences its biological activity and toxicity. This compound exhibits properties such as being a potent inhibitor of protein synthesis, leading to adverse health effects including nausea, vomiting, and immune suppression when ingested. Its solubility in polar solvents and stability under various environmental conditions contribute to its persistence in contaminated food products. Regulatory agencies monitor levels of 3-ADON in food supplies due to its potential health risks, and research continues to explore its mechanisms of action and effects on human and animal health. Understanding the characteristics of 3-Acetyldeoxynivalenol is crucial for developing strategies to mitigate its impact on food safety and public health.
Formula:C17H22O7
InChI:InChI=1S/C17H22O7/c1-8-4-11-16(6-18,13(21)12(8)20)15(3)5-10(23-9(2)19)14(24-11)17(15)7-22-17/h4,10-11,13-14,18,21H,5-7H2,1-3H3/t10-,11-,13-,14-,15-,16-,17+/m1/s1
InChI key:InChIKey=ADFIQZBYNGPCGY-HTJQZXIKSA-N
SMILES:O=C(OC1CC2(C)C3(OC3)C1OC4C=C(C(=O)C(O)C42CO)C)C
- Synonyms:
- Trichothec-9-en-8-one, 3-(acetyloxy)-12,13-epoxy-7,15-dihydroxy-, (3α,7α)-
- Dehydronivalenol monoacetate
- Deoxynivalenol monoacetate
- (3α,7α)-3-(Acetyloxy)-12,13-epoxy-7,15-dihydroxytrichothec-9-en-8-one
- Spiro[2,5-methano-1-benzoxepin-10,2′-oxirane], trichothec-9-en-8-one deriv.
