CAS 50737-32-1

5-(chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole

Description:

5-(Chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a chloromethyl group and a 2-chlorophenyl substituent, contributing to its unique reactivity and potential applications. The presence of chlorine atoms enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The oxadiazole moiety is known for its biological activity, and compounds containing this structure often exhibit antimicrobial, antifungal, or anticancer properties. Additionally, the compound's physical properties, such as solubility and melting point, can vary based on the specific substituents and their arrangement. Due to its structural characteristics, 5-(chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole may be of interest in pharmaceutical research and materials science, particularly in the development of new drugs or functional materials. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₉H₆Cl₂N₂O

InChI: InChI=1/C9H6Cl2N2O/c10-5-8-12-9(13-14-8)6-3-1-2-4-7(6)11/h1-4H,5H2

SMILES: c1ccc(c(c1)c1nc(CCl)on1)Cl

Synonyms:

• 1,2,4-Oxadiazole, 5-(chloromethyl)-3-(2-chlorophenyl)-
• 5-(Chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole

1,2,4-Oxadiazole,5-(chloromethyl)-3-(2-chlorophenyl)-

CAS: 50737-32-1

Formula: C₉H₆Cl₂N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 229.0627

Ref: IN-DA006W5Y

5-Chloromethyl-3-(2-chloro-phenyl)-[1,2,4]oxadiazole

CAS: 50737-32-1

Formula: C₉H₆Cl₂N₂O

Purity: 97.0%

Molecular weight: 229.06

Ref: 10-F040753

5-Chloromethyl-3-(2-chloro-phenyl)-[1,2,4]oxadiazole

CAS: 50737-32-1

Versatile small molecule scaffold

Formula: C₉H₆Cl₂N₂O

Purity: Min. 95%

Molecular weight: 229.06 g/mol

Ref: 3D-ACA73732