CymitQuimica logo

CAS 50737-32-1

:

5-(chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole

Description:
5-(Chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a chloromethyl group and a 2-chlorophenyl substituent, contributing to its unique reactivity and potential applications. The presence of chlorine atoms enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The oxadiazole moiety is known for its biological activity, and compounds containing this structure often exhibit antimicrobial, antifungal, or anticancer properties. Additionally, the compound's physical properties, such as solubility and melting point, can vary based on the specific substituents and their arrangement. Due to its structural characteristics, 5-(chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole may be of interest in pharmaceutical research and materials science, particularly in the development of new drugs or functional materials. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C9H6Cl2N2O
InChI:InChI=1/C9H6Cl2N2O/c10-5-8-12-9(13-14-8)6-3-1-2-4-7(6)11/h1-4H,5H2
InChI key:PUZWQESMXKKSGC-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)c1nc(CCl)on1)Cl
Synonyms:
  • 1,2,4-Oxadiazole, 5-(chloromethyl)-3-(2-chlorophenyl)-
  • 5-(Chloromethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole
Found 3 products.