CymitQuimica logo

CAS 50737-34-3

:

5-(chloromethyl)-3-ethyl-1,2,4-oxadiazole

Description:
5-(Chloromethyl)-3-ethyl-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and one oxygen atom within a five-membered ring structure. This compound features a chloromethyl group (-CH2Cl) and an ethyl group (-C2H5) attached to the oxadiazole ring, contributing to its unique chemical properties. The presence of the chloromethyl group suggests potential reactivity, making it useful in various synthetic applications, including the development of pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the electron-withdrawing nature of the chloromethyl group, which can affect nucleophilic attack and other chemical interactions. Additionally, the oxadiazole moiety is known for its stability and ability to participate in various chemical reactions, making this compound of interest in medicinal chemistry and materials science. Safety and handling precautions should be observed due to the presence of chlorine in its structure.
Formula:C5H7ClN2O
InChI:InChI=1/C5H7ClN2O/c1-2-4-7-5(3-6)9-8-4/h2-3H2,1H3
InChI key:RHMCCYHKNUZCCU-UHFFFAOYSA-N
SMILES:CCc1nc(CCl)on1
Found 3 products.