CymitQuimica logo

CAS 507484-54-0

:

Propanedinitrile, (6-fluoro-2,3-dihydro-3-oxo-1H-inden-1-ylidene)-

Description:
Propanedinitrile, (6-fluoro-2,3-dihydro-3-oxo-1H-inden-1-ylidene)-, identified by its CAS number 507484-54-0, is a chemical compound characterized by its unique structure that includes a propanedinitrile moiety and a substituted indene system. This compound features a fluorine atom, which can influence its reactivity and physical properties, such as polarity and solubility. The presence of the diketone functional group (3-oxo) contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic additions. The compound's molecular structure suggests it may exhibit interesting biological activities, which could be explored in pharmaceutical applications. Additionally, the presence of multiple functional groups indicates that it may participate in diverse chemical transformations, making it valuable in synthetic organic chemistry. Overall, propanedinitrile, (6-fluoro-2,3-dihydro-3-oxo-1H-inden-1-ylidene)- is a complex molecule with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C12H5FN2O
InChI:InChI=1S/C12H5FN2O/c13-8-1-2-9-11(3-8)10(4-12(9)16)7(5-14)6-15/h1-3H,4H2
InChI key:HSXULKAPILMKHA-UHFFFAOYSA-N
SMILES:C1C(=C(C#N)C#N)C2=C(C1=O)C=CC(=C2)F
Found 3 products.