CymitQuimica logo

CAS 50778-75-1

:

2,5-bis(trifluoroethoxy)benzoic acid hydrazide

Description:
2,5-Bis(trifluoroethoxy)benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features two trifluoroethoxy groups attached to the benzene ring, contributing to its unique properties. The presence of trifluoroethoxy groups enhances its lipophilicity and may influence its solubility in organic solvents. The hydrazide functional group can participate in various chemical reactions, making this compound potentially useful in synthetic organic chemistry and medicinal chemistry. Additionally, the trifluoromethyl groups are known for their electron-withdrawing effects, which can affect the reactivity and stability of the compound. The compound may exhibit interesting biological activities, although specific biological data would require further investigation. Overall, 2,5-bis(trifluoroethoxy)benzoic acid hydrazide is notable for its structural complexity and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H10F6N2O3
InChI:InChI=1/C11H10F6N2O3/c12-10(13,14)4-21-6-1-2-8(22-5-11(15,16)17)7(3-6)9(20)19-18/h1-3H,4-5,18H2,(H,19,20)
InChI key:WJYCMPVGQTYGSQ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1OCC(F)(F)F)C(=NN)O)OCC(F)(F)F
Synonyms:
  • 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid hydrazide
  • 2,5-Di(2,2,2-trifluoroethoxy)benzene-1-carbohydrazide
  • 2,5-Bis(2,2,2-Trifluoroethoxy)Benzohydrazide
Found 2 products.