CAS 508-04-3
:δ-Amyrin
Description:
δ-Amyrin is a triterpenoid compound classified under the class of pentacyclic triterpenes, primarily found in various plant species, particularly in the resin of certain trees and in the leaves of some medicinal plants. It has a molecular formula of C30H50O and features a complex structure characterized by five interconnected rings. δ-Amyrin exhibits a range of biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in pharmacological research. Its solubility is generally low in water but higher in organic solvents, which is typical for many terpenoids. The compound is often studied for its potential therapeutic applications, including its role in traditional medicine. Additionally, δ-Amyrin can serve as a precursor for the synthesis of other bioactive compounds. Its presence in essential oils and resins contributes to the aroma and flavor profiles of various plants, further highlighting its significance in both natural products chemistry and potential industrial applications.
Formula:C30H50O
InChI:InChI=1S/C30H50O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h22-24,31H,9-19H2,1-8H3/t22-,23+,24-,27+,28-,29+,30+/m0/s1
InChI key:InChIKey=JOCIRBSYAYKMEF-YDPPSCFKSA-N
SMILES:C[C@]12[C@@]3(C)C(=C4[C@@](C)(CC3)CCC(C)(C)C4)CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@@H](O)CC5)[H])[H]
Synonyms:- δ-Amyrenol
- (3β)-Olean-13(18)-en-3-ol
- Olean-13(18)-en-3β-ol
- Olean-13(18)-en-3-ol, (3β)-
- δ-Amyrin
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
13(18)-Oleanen-3-ol
CAS:13(18)-Oleanen-3-ol is a natural product from Scaevola floribunda bark.Formula:C30H50OPurity:98.39%Color and Shape:White SolidMolecular weight:426.7174δ-Amyrin
CAS:Controlled Productδ-Amyrin is a β-amyrin, a triterpene alcohol that is present in plants. It has been suggested to have anti-inflammatory properties and to inhibit lipoprotein lipase activity. δ-Amyrin is found in the leaves of Capsicum annuum (red pepper) and can be extracted with a solvent or by chemical ionization. The compound has been shown to react with carbonyl groups and fatty acids, suggesting it may act as an antioxidant. δ-Amyrin has also been shown to inhibit the growth of murine hepatoma cells through the transcription-polymerase chain reaction (PCR).Formula:C30H50OPurity:Min. 95%Molecular weight:426.7 g/mol






