CymitQuimica logo

CAS 50820-65-0

:

Indole-6-carboxylic acid methyl ester

Description:
Indole-6-carboxylic acid methyl ester, with the CAS number 50820-65-0, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid group that is esterified with a methyl group, enhancing its solubility and reactivity. Indole derivatives are known for their biological significance, often exhibiting various pharmacological activities, including antimicrobial and anticancer properties. The methyl ester form can facilitate easier handling and incorporation into biological systems. In terms of physical properties, it is typically a solid or liquid at room temperature, depending on its purity and specific conditions. The compound is generally stable under standard laboratory conditions but may be sensitive to strong acids or bases. Its synthesis often involves the reaction of indole-6-carboxylic acid with methanol in the presence of an acid catalyst. Overall, indole-6-carboxylic acid methyl ester serves as a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c1-13-10(12)8-3-2-7-4-5-11-9(7)6-8/h2-6,11H,1H3
InChI key:InChIKey=AYYOZKHMSABVRP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C2C(=CC1)C=CN2
Synonyms:
  • 1H-Indole-6-carboxylic acid, methyl ester
  • 6-Indole carboxylic acid methyl ester
  • 6-Methoxycarbonylindole
  • Indole-6-carboxylic acid methyl ester
  • Methyl 6-indolecarboxylate
  • methyl 1H-indole-6-carboxylate
Found 8 products.