CymitQuimica logo

CAS 50824-04-9

:

4-Bromo-2-(trifluoromethyl)phenol

Description:
4-Bromo-2-(trifluoromethyl)phenol is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to a phenolic structure. Its molecular formula is C7H4BrF3O, indicating the presence of seven carbon atoms, four hydrogen atoms, one bromine atom, three fluorine atoms, and one oxygen atom. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties imparted by the trifluoromethyl group. The bromine and trifluoromethyl substituents enhance its reactivity and influence its solubility in various solvents. Additionally, 4-Bromo-2-(trifluoromethyl)phenol may exhibit biological activity, making it of interest in medicinal chemistry. Safety data sheets should be consulted for handling precautions, as halogenated compounds can pose environmental and health risks. Overall, this compound serves as a valuable building block in synthetic organic chemistry, contributing to the development of more complex molecules.
Formula:C7H4BrF3O
InChI:InChI=1/C7H4BrF3O/c8-4-1-2-6(12)5(3-4)7(9,10)11/h1-3,12H
InChI key:PDPGERGWEOJVDC-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)C(F)(F)F)O
Synonyms:
  • 5-Bromo-2-hydroxybenzotrifluoride
Found 7 products.