CAS 50827-57-1

2-hydroxymethyl-6-methoxy-1,4-benzoquinone

Description:

2-Hydroxymethyl-6-methoxy-1,4-benzoquinone, with the CAS number 50827-57-1, is a chemical compound that belongs to the class of benzoquinones, which are characterized by a six-membered aromatic ring with two carbonyl groups. This particular compound features a hydroxymethyl group and a methoxy group, which contribute to its unique chemical properties. It is typically a yellow to orange solid, indicating its potential for colorimetric applications. The presence of the hydroxymethyl group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The methoxy group can enhance the compound's lipophilicity, affecting its interaction with biological systems. 2-Hydroxymethyl-6-methoxy-1,4-benzoquinone may exhibit antioxidant properties, making it of interest in various fields, including pharmaceuticals and materials science. Its reactivity can also be attributed to the quinone structure, which is known for undergoing redox reactions. Overall, this compound's unique functional groups and structural characteristics make it a subject of interest for further research and potential applications.

Formula: C₈H₈O₄

InChI: InChI=1/C8H8O4/c1-12-7-3-6(10)2-5(4-9)8(7)11/h2-3,9H,4H2,1H3

InChI key: PXEBZHWTQGYVCO-UHFFFAOYSA-N

SMILES: COC1=CC(=O)C=C(CO)C1=O

2-Hydroxymethyl-6-methoxy-1,4-benzoquinone

CAS: 50827-57-1

Formula: C₈H₈O₄

Molecular weight: 168.1467

Ref: IN-DA003HFP