CymitQuimica logo

CAS 50836-82-3

:

Propanamide, N-methyl-3-(methylamino)-

Description:
Propanamide, N-methyl-3-(methylamino)-, also known by its CAS number 50836-82-3, is an organic compound characterized by its amide functional group, which is derived from propanoic acid. This compound features a propanamide backbone with a methyl group and a methylamino group attached to the nitrogen atom, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of both methyl and methylamino groups enhances its solubility in polar solvents, making it useful in various chemical applications. Propanamide derivatives are often studied for their potential biological activities, including roles in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit moderate to low toxicity, necessitating careful handling in laboratory settings. Its molecular structure allows for hydrogen bonding, influencing its physical properties such as boiling point and melting point. Overall, N-methyl-3-(methylamino)propanamide is a compound of interest in organic synthesis and medicinal chemistry.
Formula:C5H12N2O
InChI:InChI=1S/C5H12N2O/c1-6-4-3-5(8)7-2/h6H,3-4H2,1-2H3,(H,7,8)
InChI key:BZAGWSIKXFPLND-UHFFFAOYSA-N
SMILES:CNCCC(=O)NC
Synonyms:
  • N-ethyl--methylamino)Propanamide
  • N-Methyl-3-(methylamino)
  • N~1~,N~3~-dimethyl-beta-alaninamide(SALTDATA: HCl)
  • N-Methyl-3-(methylamino)propionamide
  • Propanamide, N-methyl-3-(methylamino)-
Found 3 products.