CymitQuimica logo

CAS 50839-66-2

:

1-(2-Hydroxyethyl)-2,3,3-trimethyl-3H-indolium iodide

Description:
1-(2-Hydroxyethyl)-2,3,3-trimethyl-3H-indolium iodide is a quaternary ammonium compound characterized by its indolium structure, which features a positively charged nitrogen atom within a five-membered aromatic ring. This compound typically appears as a solid or crystalline material and is soluble in polar solvents due to the presence of the hydroxyethyl group, which enhances its hydrophilicity. The iodide counterion contributes to its ionic nature, influencing its solubility and reactivity. This substance is often utilized in various applications, including as a dye or in biological studies due to its fluorescent properties. Its stability can be affected by environmental factors such as temperature and pH, and it may exhibit specific interactions with biological molecules, making it of interest in biochemical research. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards. Overall, this compound exemplifies the intersection of organic chemistry and materials science, showcasing the diverse functionalities of indolium derivatives.
Formula:C13H18INO
InChI:InChI=1/C13H18NO.HI/c1-10-13(2,3)11-6-4-5-7-12(11)14(10)8-9-15;/h4-7,15H,8-9H2,1-3H3;1H/q+1;/p-1
InChI key:YSFWRUFAUVRBMQ-UHFFFAOYSA-M
SMILES:CC1=[N+](C2=CC=CC=C2C1(C)C)CCO.[I-]
Found 3 products.