CymitQuimica logo

CAS 50882-29-6

:

Phenyl N-(4-bromophenyl)carbamate

Description:
Phenyl N-(4-bromophenyl)carbamate, with the CAS number 50882-29-6, is an organic compound characterized by its carbamate functional group, which consists of a phenyl group attached to a nitrogen atom that is also bonded to a 4-bromophenyl moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as dichloromethane and acetone, but has limited solubility in water. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both phenyl groups that can influence biological activity. The bromine substituent on the aromatic ring may enhance the compound's reactivity and lipophilicity, making it a candidate for further chemical modifications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in various chemical processes.
Formula:C13H10BrNO2
InChI:InChI=1S/C13H10BrNO2/c14-10-6-8-11(9-7-10)15-13(16)17-12-4-2-1-3-5-12/h1-9H,(H,15,16)
InChI key:InChIKey=DFVROMJTBLOOGY-UHFFFAOYSA-N
SMILES:N(C(OC1=CC=CC=C1)=O)C2=CC=C(Br)C=C2
Synonyms:
  • Carbamic acid, (4-bromophenyl)-, phenyl ester
  • Phenyl N-(4-bromophenyl)carbamate
  • Phenyl (4-bromophenyl)carbamate
  • Carbamic acid, N-(4-bromophenyl)-, phenyl ester
Found 3 products.