CymitQuimica logo

CAS 50885-01-3

:

2-amino-3-fluorobutyric acid

Description:
2-Amino-3-fluorobutyric acid, with the CAS number 50885-01-3, is an amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) in its structure, along with a fluorine atom attached to the third carbon of the butyric acid chain. This compound is typically a white crystalline solid at room temperature and is soluble in water due to its polar functional groups. The presence of the fluorine atom can influence its chemical reactivity and biological activity, potentially affecting its role in biochemical pathways. As an amino acid, it can participate in peptide synthesis and may have applications in pharmaceuticals or as a biochemical probe. Its unique structure may also impart specific properties, such as altered pKa values compared to non-fluorinated analogs, which can affect its behavior in biological systems. Overall, 2-amino-3-fluorobutyric acid is of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C4H8FNO2
InChI:InChI=1/C4H8FNO2/c1-2(5)3(6)4(7)8/h2-3H,6H2,1H3,(H,7,8)
InChI key:HJVQOHDATXHIJL-UHFFFAOYSA-N
SMILES:CC(C(C(=O)O)N)F
Synonyms:
  • 2-Amino-3-Fluorobutanoic Acid
Found 1 products.