CAS 50894-66-1

(+)-alpha-funebrene

Description:

(+)-Alpha-funebrene is a naturally occurring sesquiterpene hydrocarbon characterized by its unique structural configuration and stereochemistry. It is derived from various plant sources and is known for its role in the fragrance and flavor industry due to its pleasant aroma. The compound features a bicyclic structure, which contributes to its distinctive properties. (+)-Alpha-funebrene is typically colorless to pale yellow in appearance and is insoluble in water but soluble in organic solvents. Its molecular formula reflects a relatively simple composition, which is common among terpenes. The compound exhibits interesting biological activities, including potential antimicrobial and insecticidal properties, making it of interest in both natural product chemistry and agricultural applications. Additionally, its enantiomeric form may exhibit different biological activities, highlighting the importance of stereochemistry in the study of terpenes. Overall, (+)-alpha-funebrene serves as a valuable compound in various fields, including perfumery, food flavoring, and potential therapeutic applications.

Formula: C₁₅H₂₄

InChI: InChI=1/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12-,13+,15-/m1/s1

InChI key: IRAQOCYXUMOFCW-GUIRCDHDSA-N

SMILES: C[C@@H]1CC[C@@H]2[C@@]13CC=C([C@@H](C3)C2(C)C)C

(+)-α-Funebrene

CAS: 50894-66-1

Formula: C₁₅H₂₄

Molecular weight: 204.3511

Ref: IN-DA003BDH