CAS 50912-65-7

2-(2,4-Dimethylphenoxy)ethanamine

Description:

2-(2,4-Dimethylphenoxy)ethanamine, with the CAS number 50912-65-7, is an organic compound characterized by its amine functional group and ether linkage. This substance features a 2,4-dimethylphenyl group attached to an ethanamine backbone, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the dimethyl groups on the aromatic ring enhances its hydrophobic characteristics, while the amine group can engage in hydrogen bonding, influencing its solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its reactivity can be attributed to the amine group, which can participate in nucleophilic substitution reactions and form salts with acids. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-(2,4-Dimethylphenoxy)ethanamine is a compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₀H₁₅NO

InChI: InChI=1S/C10H15NO/c1-8-3-4-10(9(2)7-8)12-6-5-11/h3-4,7H,5-6,11H2,1-2H3

InChI key: InChIKey=WTMWXJLUFMRFBV-UHFFFAOYSA-N

SMILES: O(CCN)C1=C(C)C=C(C)C=C1

Synonyms:

• 1-(2-Aminoethoxy)-2,4-dimethylbenzene
• 2-(2,4-Dimethylphenoxy)ethan-1-amine
• 2-(2,4-Dimethylphenoxy)ethylamine
• Ethanamine, 2-(2,4-Dimethylphenoxy)-
• 2-(2,4-Dimethylphenoxy)ethanamine

2-(2,4-Dimethyl-phenoxy)-ethylamine

CAS: 50912-65-7

Formula: C₁₀H₁₅NO

Molecular weight: 165.236

Ref: 10-F060050