CymitQuimica logo

CAS 50921-39-6

:

1-(4-Chlorophenyl)cyclobutanecarboxylic acid

Description:
1-(4-Chlorophenyl)cyclobutanecarboxylic acid is an organic compound characterized by its cyclobutane ring structure substituted with a 4-chlorophenyl group and a carboxylic acid functional group. The presence of the chlorophenyl moiety contributes to its potential biological activity and lipophilicity, while the cyclobutane ring introduces strain and unique conformational properties. This compound typically exhibits solid-state characteristics at room temperature and may have moderate solubility in organic solvents, depending on the specific conditions. The carboxylic acid group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit acidic properties, allowing it to donate protons in solution. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, where the chlorophenyl group may enhance activity against specific biological targets. Overall, 1-(4-Chlorophenyl)cyclobutanecarboxylic acid is of interest in synthetic organic chemistry and medicinal chemistry due to its unique structural attributes and potential functional applications.
Formula:C11H11ClO2
InChI:InChI=1S/C11H11ClO2/c12-9-4-2-8(3-5-9)11(10(13)14)6-1-7-11/h2-5H,1,6-7H2,(H,13,14)
InChI key:InChIKey=XYSRHOKREWGGFE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCC1)C2=CC=C(Cl)C=C2
Synonyms:
  • 1-(4-Chlorophenyl)-1-Cyclobutane- Carboxylic Acid 94%
  • 1-(4-Chlorophenyl)-1-Cyclobutanecarboxylic Acid
  • 1-(4-Chlorophenyl)Cyclobutanecarboxylate
  • 1-(4-Chlorophenyl)Cyclobutanecarboxylic Acid
  • 1-(4-Chlorophenyl)cyclobutanecarboxylicacid
  • 1-(P-Chlorophenyl)Cyclobutanecarboxylic Acid
  • Cyclobutanecarboxylic acid, 1-(4-chlorophenyl)-
  • Timtec-Bb Sbb003443
Found 4 products.