CymitQuimica logo

CAS 5096-73-1

:

6-Chloro-3-pyridazinecarboxylic acid

Description:
6-Chloro-3-pyridazinecarboxylic acid is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a carboxylic acid functional group (-COOH) at the 3-position and a chlorine atom at the 6-position contributes to its chemical reactivity and properties. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting the influence of the carboxylic acid group. It may exhibit acidic behavior due to the carboxylic acid, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the chlorine substituent can enhance the compound's reactivity in nucleophilic substitution reactions. 6-Chloro-3-pyridazinecarboxylic acid is of interest in medicinal chemistry and agrochemicals, where it may serve as a building block for the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H3ClN2O2
InChI:InChI=1S/C5H3ClN2O2/c6-4-2-1-3(5(9)10)7-8-4/h1-2H,(H,9,10)
InChI key:InChIKey=HHGZQZULOHYEOH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(Cl)N=N1
Synonyms:
  • 3-Chloropyridazine-6-carboxylic acid
  • 3-Pyridazinecarboxylic acid, 6-chloro-
  • 6-Chloro-3-pyridazinecarboxylic acid
  • 6-Chloropyridazine-3-formic acid
  • Acide 6-chloropyridazine-3-carboxylique
Found 4 products.