CAS 50978-45-5

3-oxobenzo[d]isothiazole-2(3H)-carbaldehyde 1,1-dioxide

Description:

3-Oxobenzo[d]isothiazole-2(3H)-carbaldehyde 1,1-dioxide, with the CAS number 50978-45-5, is a heterocyclic compound characterized by its unique structure that incorporates both isothiazole and aldehyde functionalities. This compound features a benzo fused to an isothiazole ring, which contributes to its potential biological activity. The presence of the oxo group and the aldehyde moiety suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. The 1,1-dioxide functional group indicates that the compound has two oxygen atoms bonded to the sulfur atom in the isothiazole ring, enhancing its reactivity and solubility in polar solvents. Such structural characteristics often lead to interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence or other optical properties, which can be useful in various applications, including materials science and biological imaging. Overall, 3-oxobenzo[d]isothiazole-2(3H)-carbaldehyde 1,1-dioxide is a versatile compound with potential applications in research and industry.

Formula: C8H5NO4S

InChI: InChI=1S/C8H5NO4S/c10-5-9-8(11)6-3-1-2-4-7(6)14(9,12)13/h1-5H

InChI key: LMPIFZSJKLLOLM-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)C=O

N-Formylsaccharin

CAS: 50978-45-5

Formula: C₈H₅NO₄S

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 211.19

Ref: 3B-F0854

N-Formylsaccharin

CAS: 50978-45-5

N-Formylsaccharin

Formula: C₈H₅NO₄S

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 211.1946

Ref: 54-OR939711

N-FORMYLSACCHARIN

CAS: 50978-45-5

Formula: C₈H₅NO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.1946

Ref: IN-DA003AM8

3-Oxobenzo[d]isothiazole-2(3H)-carbaldehyde 1,1-dioxide

CAS: 50978-45-5

Purity: 97%

Molecular weight: 211.1900024

Ref: 10-F612314

3-Oxobenzo[d]isothiazole-2(3H)-carbaldehyde 1,1-dioxide

CAS: 50978-45-5

3-Oxobenzo[d]isothiazole-2(3H)-carbaldehyde 1,1-dioxide

Formula: C₈H₅NO₄S

Purity: 95%

Molecular weight: 211.19

Ref: IN-DG285433

N-Formylsaccharin

CAS: 50978-45-5

N-Formylsaccharin is a formylating agent that reacts with nucleophiles such as primary amines or azides to produce formyl derivatives. It is also an efficient synthetic method for the synthesis of formylated molecules and can be used to recycle organic waste. N-Formylsaccharin has been shown to react with a wide range of functional groups, including alcohols, aldehydes, ketones, carboxylic acids and amines. However, it does not react with nitriles or esters because they have no lone pairs available. N-Formylsaccharin is stable in water but decomposes when heated to high temperatures.

Formula: C₈H₅NO₄S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 211.2 g/mol

Ref: 3D-FF35183