CAS 51-39-8
:3,4,5-Trichlorobenzoic acid
Description:
3,4,5-Trichlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of three chlorine atoms substituted at the 3, 4, and 5 positions on the benzene ring of benzoic acid. Its molecular formula is C7H3Cl3O2, and it features a carboxylic acid functional group (-COOH) that imparts acidic properties. This compound is typically a white to off-white crystalline solid, and it is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. 3,4,5-Trichlorobenzoic acid is known for its applications in organic synthesis, particularly as an intermediate in the production of herbicides and other agrochemicals. It also serves as a reagent in various chemical reactions, including chlorination and acylation processes. Due to the presence of chlorine atoms, it exhibits significant environmental persistence and potential toxicity, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C7H3Cl3O2
InChI:InChI=1/C7H3Cl3O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12)
InChI key:InChIKey=ICUICNRYLHKQGS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1
Synonyms:- 3,4,5-Trichlorobenzoicacid
- Benzoic Acid, 3,4,5-Trichloro-
- 3,4,5-Trichlorobenzoic acid
- Ai3-33273
- 3,4,5-TRICHLORO-BENZOICACID
- Brn 3267440
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4,5-Trichlorobenzoic acid
CAS:3,4,5-Trichlorobenzoic acidFormula:C7H3Cl3O2Purity:98%Molecular weight:225.463,4,5-Trichlorobenzoic acid
CAS:Formula:C7H3Cl3O2Purity:%Color and Shape:SolidMolecular weight:225.45653,4,5-Trichlorobenzoic acid
CAS:3,4,5-Trichlorobenzoic acidFormula:C7H3Cl3O2Purity:95%Molecular weight:225.463,4,5-Trichloro-benzoic acid
CAS:Formula:C7H3Cl3O2Purity:98%Color and Shape:SolidMolecular weight:225.453,4,5-Trichlorobenzoic acid
CAS:Trichlorobenzoic acid is a chemical compound that is found in plants, such as Trifolium pratense L. and other legumes. It has been shown to inhibit the growth of bacteria by competitive inhibition of the enzyme ribonucleotide reductase, which catalyzes the conversion of ribonucleotides to deoxyribonucleotides. This prevents the production of RNA, which is necessary for protein synthesis and cell division. Inhibition of this enzyme can be achieved by either conjugating trichlorobenzoic acid with a sugar or using ion-exchange resins to remove it from water. The concentration required for this type of inhibition varies depending on the type of organism, but generally ranges between 5-10 ppm.END>
Purity:Min. 95%




