CymitQuimica logo

CAS 51013-67-3

:

4-(Morpholinomethyl)aniline

Description:
4-(Morpholinomethyl)aniline, with the CAS number 51013-67-3, is an organic compound characterized by the presence of both an aniline and a morpholine functional group. This compound typically appears as a solid or liquid, depending on its specific form and purity. It features a morpholinomethyl group attached to the para position of the aniline ring, which contributes to its unique chemical properties. The morpholine ring, a six-membered heterocycle containing one oxygen and one nitrogen atom, imparts certain polar characteristics, enhancing solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structure allows for potential interactions with various biological targets, which can be explored in medicinal chemistry. Additionally, 4-(Morpholinomethyl)aniline may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c12-11-3-1-10(2-4-11)9-13-5-7-14-8-6-13/h1-4H,5-9,12H2
InChI key:WNYFVEFUHMDIRQ-UHFFFAOYSA-N
SMILES:c1cc(ccc1CN1CCOCC1)N
Synonyms:
  • 4-(Morpholin-4-ylmethyl)aniline
  • Benzenamine, 4-(4-morpholinylmethyl)-
Found 5 products.