CAS 51022-74-3
:Iotroxic acid
Description:
Iotroxic acid, with the CAS number 51022-74-3, is a chemical compound that belongs to the class of organic acids. It is characterized by its unique molecular structure, which includes functional groups that contribute to its acidic properties. Typically, compounds like iotroxic acid exhibit solubility in polar solvents, such as water, due to the presence of hydrophilic groups. This solubility can influence its reactivity and interaction with biological systems. Iotroxic acid may also possess specific biological activities, making it of interest in pharmaceutical research or other applications. Its stability, pH-dependent behavior, and potential for forming salts or esters are important characteristics that can affect its use in various chemical processes. As with many organic acids, safety considerations, including toxicity and environmental impact, are crucial when handling iotroxic acid. Overall, its distinct properties make it a subject of interest in both academic and industrial chemistry contexts.
Formula:C22H18I6N2O9
InChI:InChI=1S/C22H18I6N2O9/c23-9-5-11(25)19(17(27)15(9)21(33)34)29-13(31)7-38-3-1-37-2-4-39-8-14(32)30-20-12(26)6-10(24)16(18(20)28)22(35)36/h5-6H,1-4,7-8H2,(H,29,31)(H,30,32)(H,33,34)(H,35,36)
InChI key:InChIKey=JXMIBUGMYLQZGO-UHFFFAOYSA-N
SMILES:N(C(COCCOCCOCC(NC1=C(I)C(C(O)=O)=C(I)C=C1I)=O)=O)C2=C(I)C(C(O)=O)=C(I)C=C2I
Synonyms:- Benzoic acid, 3,3′-[oxybis[2,1-ethanediyloxy(1-oxo-2,1-ethanediyl)imino]]bis[2,4,6-triiodo-
- 3,3′-[Oxybis[2,1-ethanediyloxy(1-oxo-2,1-ethanediyl)imino]]bis[2,4,6-triiodobenzoic acid]
- Iotroxic acid
- Biliscopin
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
