CymitQuimica logo

CAS 51024-64-7

:

Ruscoside

Description:
Ruscoside, with the CAS number 51024-64-7, is a natural compound primarily derived from the plant Ruscus aculeatus, commonly known as butcher's broom. It is classified as a saponin, which is a type of glycoside that can produce a lather when mixed with water. Ruscoside is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and diuretic effects. It has been studied for its role in promoting venous health and alleviating symptoms associated with chronic venous insufficiency. The compound exhibits a complex structure characterized by a steroidal backbone, which contributes to its biological activity. Additionally, ruscoside may interact with various biological pathways, making it of interest in herbal medicine and dietary supplements. Its safety profile and efficacy are still subjects of ongoing research, and while it is generally considered safe when used appropriately, further studies are necessary to fully understand its therapeutic potential and mechanisms of action.
Formula:C50H80O23
InChI:InChI=1S/C50H80O23/c1-19(17-65-44-39(61)37(59)35(57)29(15-51)68-44)8-11-50(64)20(2)32-28(73-50)14-26-24-7-6-22-12-23(53)13-31(49(22,5)25(24)9-10-48(26,32)4)70-47-43(34(56)27(54)18-66-47)72-46-41(63)42(33(55)21(3)67-46)71-45-40(62)38(60)36(58)30(16-52)69-45/h6,20-21,23-47,51-64H,1,7-18H2,2-5H3/t20-,21-,23+,24+,25-,26-,27-,28-,29+,30+,31+,32-,33-,34-,35+,36+,37-,38-,39+,40+,41+,42+,43+,44+,45-,46-,47-,48-,49-,50+/m0/s1
InChI key:InChIKey=JWGLJRXUTIFBHW-MTRMYNQZSA-N
SMILES:C[C@@]12[C@]([C@]3([C@](CC1)([C@@]4(C)[C@H](O[C@H]5[C@H](O[C@H]6[C@H](O)[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@@H](O)CO5)C[C@H](O)CC4=CC3)[H])[H])(C[C@]8([C@@]2([C@H](C)[C@](CCC(CO[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)=C)(O)O8)[H])[H])[H]
Synonyms:
  • Ruscoside
  • β-D-Glucopyranoside, (1β,3β)-1-[(O-β-D-glucopyranosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-α-L-arabinopyranosyl)oxy]-3,22-dihydroxyfurosta-5,25(27)-dien-26-yl
  • (1β,3β)-1-[(O-β-D-Glucopyranosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-α-L-arabinopyranosyl)oxy]-3,22-dihydroxyfurosta-5,25(27)-dien-26-yl β-D-glucopyranoside
Found 1 products.