CymitQuimica logo

CAS 51029-15-3

:

Piperidine, 1-[(trifluoromethyl)sulfonyl]-

Description:
Piperidine, 1-[(trifluoromethyl)sulfonyl]- is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a trifluoromethylsulfonyl group (-SO2CF3) significantly influences its chemical properties, making it a potent electrophile. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its high reactivity, particularly in nucleophilic substitution reactions, due to the electron-withdrawing nature of the trifluoromethyl group. Piperidine derivatives are often utilized in the synthesis of pharmaceuticals and agrochemicals, owing to their ability to act as intermediates in various chemical reactions. Additionally, the sulfonyl group enhances solubility in polar solvents, which can be advantageous in synthetic applications. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to skin and eyes, and potential toxicity if ingested or inhaled.
Formula:C6H10F3NO2S
InChI:InChI=1S/C6H10F3NO2S/c7-6(8,9)13(11,12)10-4-2-1-3-5-10/h1-5H2
InChI key:MBLHRHYLNYFCEV-UHFFFAOYSA-N
SMILES:C1CCN(CC1)S(=O)(=O)C(F)(F)F
Synonyms:
  • Piperidine, 1-[(trifluoromethyl)sulfonyl]-
  • 1-(Trifluoromethylsulfonyl)piperidine
Found 4 products.