CymitQuimica logo

CAS 51045-35-3

:

1-(2-cyanophenyl)-N-methylmethanesulfonamide

Description:
1-(2-Cyanophenyl)-N-methylmethanesulfonamide, identified by its CAS number 51045-35-3, is a chemical compound characterized by its sulfonamide functional group, which is known for its applications in medicinal chemistry. This compound features a cyanophenyl moiety, indicating the presence of a cyano group (-CN) attached to a phenyl ring, which can influence its electronic properties and reactivity. The N-methyl group suggests that the nitrogen atom in the sulfonamide is substituted with a methyl group, potentially affecting the compound's solubility and biological activity. Generally, sulfonamides exhibit antibacterial properties, and the presence of the cyano group may enhance their pharmacological profile. The compound is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the sulfonamide group. Its structural characteristics may allow for interactions with biological targets, making it of interest in drug development and research. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.
Formula:C9H10N2O2S
InChI:InChI=1/C9H10N2O2S/c1-11-14(12,13)7-9-5-3-2-4-8(9)6-10/h2-5,11H,7H2,1H3
InChI key:WNDNPRAXAXKVGM-UHFFFAOYSA-N
SMILES:CNS(=O)(=O)Cc1ccccc1C#N
Found 2 products.